C20H28F2O4 — CID 69053620
[7-(1,1-difluoroprop-1-en-2-yl)-2,2,5,10-tetramethyl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl] acetate (PubChem CID 69053620) has the molecular formula C20H28F2O4 and a molecular weight of 370.44 g/mol. Its IUPAC name is [7-(1,1-difluoroprop-1-en-2-yl)-2,2,5,10-tetramethyl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl] acetate.
| Compound Name | [7-(1,1-difluoroprop-1-en-2-yl)-2,2,5,10-tetramethyl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 69053620 |
| Molecular Formula | C20H28F2O4 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [7-(1,1-difluoroprop-1-en-2-yl)-2,2,5,10-tetramethyl-4,6a,7,8,9,10-hexahydro-3aH-benzo[h][1,3]benzodioxol-4-yl] acetate |
| SMILES | CC(=O)OC1C(C)=CC2C(C(C)=C(F)F)CCC(C)C23OC(C)(C)OC13 |
| InChI | InChI=1S/C20H28F2O4/c1-10-9-15-14(12(3)18(21)22)8-7-11(2)20(15)17(16(10)24-13(4)23)25-19(5,6)26-20/h9,11,14-17H,7-8H2,1-6H3 |
| InChIKey | RUDMJMCDWBJYHM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|