C15H29NOSi — CID 173135674
N-(2-ethenyl-3,3,5,5,6-pentamethyl-2-silyloct-7-en-4-ylidene)hydroxylamine (PubChem CID 173135674) has the molecular formula C15H29NOSi and a molecular weight of 267.49 g/mol. Its IUPAC name is N-(2-ethenyl-3,3,5,5,6-pentamethyl-2-silyloct-7-en-4-ylidene)hydroxylamine.
| Compound Name | N-(2-ethenyl-3,3,5,5,6-pentamethyl-2-silyloct-7-en-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 173135674 |
| Molecular Formula | C15H29NOSi |
| Molecular Weight | 267.49 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-(2-ethenyl-3,3,5,5,6-pentamethyl-2-silyloct-7-en-4-ylidene)hydroxylamine |
| SMILES | C=CC(C)C(C)(C)C(=NO)C(C)(C)C(C)([SiH3])C=C |
| InChI | InChI=1S/C15H29NOSi/c1-9-11(3)13(4,5)12(16-17)14(6,7)15(8,18)10-2/h9-11,17H,1-2H2,3-8,18H3 |
| InChIKey | VNYGDLUNQIUBLQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|