C15H29NO — CID 155125098
(NZ)-N-(2,5,5,7,7,8-hexamethylnon-2-en-6-ylidene)hydroxylamine (PubChem CID 155125098) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is (NZ)-N-(2,5,5,7,7,8-hexamethylnon-2-en-6-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(2,5,5,7,7,8-hexamethylnon-2-en-6-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 155125098 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (NZ)-N-(2,5,5,7,7,8-hexamethylnon-2-en-6-ylidene)hydroxylamine |
| SMILES | CC(C)=CCC(C)(C)/C(=N/O)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H29NO/c1-11(2)9-10-14(5,6)13(16-17)15(7,8)12(3)4/h9,12,17H,10H2,1-8H3/b16-13- |
| InChIKey | DMZPIYRZZWZSID-SSZFMOIBSA-N |
| XLogP | 4.88 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|