C21H32FN3O3S — CID 173136198
1-cyclooctyl-3-[[1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methyl]urea (PubChem CID 173136198) has the molecular formula C21H32FN3O3S and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-cyclooctyl-3-[[1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methyl]urea.
| Compound Name | 1-cyclooctyl-3-[[1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 173136198 |
| Molecular Formula | C21H32FN3O3S |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 1-cyclooctyl-3-[[1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methyl]urea |
| SMILES | O=C(NCC1CCCCN1S(=O)(=O)c1ccc(F)cc1)NC1CCCCCCC1 |
| InChI | InChI=1S/C21H32FN3O3S/c22-17-11-13-20(14-12-17)29(27,28)25-15-7-6-10-19(25)16-23-21(26)24-18-8-4-2-1-3-5-9-18/h11-14,18-19H,1-10,15-16H2,(H2,23,24,26) |
| InChIKey | JTUURKRWPMPUAB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |