C21H31FN2O4S — CID 173136001
N-[[1-(4-fluoro-3-hydroxyphenyl)sulfonylpiperidin-2-yl]methyl]cyclooctanecarboxamide (PubChem CID 173136001) has the molecular formula C21H31FN2O4S and a molecular weight of 426.55 g/mol. Its IUPAC name is N-[[1-(4-fluoro-3-hydroxyphenyl)sulfonylpiperidin-2-yl]methyl]cyclooctanecarboxamide.
| Compound Name | N-[[1-(4-fluoro-3-hydroxyphenyl)sulfonylpiperidin-2-yl]methyl]cyclooctanecarboxamide |
|---|---|
| PubChem CID | 173136001 |
| Molecular Formula | C21H31FN2O4S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | N-[[1-(4-fluoro-3-hydroxyphenyl)sulfonylpiperidin-2-yl]methyl]cyclooctanecarboxamide |
| SMILES | O=C(NCC1CCCCN1S(=O)(=O)c1ccc(F)c(O)c1)C1CCCCCCC1 |
| InChI | InChI=1S/C21H31FN2O4S/c22-19-12-11-18(14-20(19)25)29(27,28)24-13-7-6-10-17(24)15-23-21(26)16-8-4-2-1-3-5-9-16/h11-12,14,16-17,25H,1-10,13,15H2,(H,23,26) |
| InChIKey | RHAWIZSUNCLQIW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |