About 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid
2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid (PubChem CID 173139303) has the molecular formula C7H20N4O18P2
and a molecular weight of 510.20 g/mol. Its IUPAC name is 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid.
Molecular Properties
| Compound Name | 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid |
| PubChem CID | 173139303 |
| Molecular Formula | C7H20N4O18P2 |
| Molecular Weight | 510.20 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid |
| SMILES | C=O.O=P(O)(O)O.O=P(O)(O)O.O=[N+]([O-])OCCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-] |
| InChI | InChI=1S/C6H12N4O9.CH2O.2H3O4P/c11-8(12)17-4-1-7(2-5-18-9(13)14)3-6-19-10(15)16;1-2;2*1-5(2,3)4/h1-6H2;1H2;2*(H3,1,2,3,4) |
| InChIKey | KAHLCTNFYBEFLB-UHFFFAOYSA-N |
| XLogP | -3.13 |
| TPSA | 332.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 510.20 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid?
The IUPAC name of 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid (CID 173139303) is 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid.
What is the SMILES notation for 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid?
The canonical SMILES for 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid is C=O.O=P(O)(O)O.O=P(O)(O)O.O=[N+]([O-])OCCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-].
What is the InChIKey of 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid?
The InChIKey is KAHLCTNFYBEFLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O9.CH2O.2H3O4P/c11-8(12)17-4-1-7(2-5-18-9(13)14)3-6-19-10(15)16;1-2;2*1-5(2,3)4/h1-6H2;1H2;2*(H3,1,2,3,4).
What are the key properties of 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid?
2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid has a molecular weight of 510.20 g/mol, XLogP of -3.13, 12 rotatable bonds, 6 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate;formaldehyde;phosphoric acid is sourced from PubChem (CID 173139303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).