C31H38N4O4 — CID 173143108
2-[[2-[4-[(2-hydroxyethylamino)methyl]phenyl]acetyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate (PubChem CID 173143108) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-[[2-[4-[(2-hydroxyethylamino)methyl]phenyl]acetyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate.
| Compound Name | 2-[[2-[4-[(2-hydroxyethylamino)methyl]phenyl]acetyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate |
|---|---|
| PubChem CID | 173143108 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 2-[[2-[4-[(2-hydroxyethylamino)methyl]phenyl]acetyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate |
| SMILES | O=C(Cc1ccc(CNCCO)cc1)NCCOC(=O)N(c1ccccc1-c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C31H38N4O4/c36-21-17-32-24-26-15-13-25(14-16-26)23-30(37)33-18-22-39-31(38)35(34-19-7-2-8-20-34)29-12-6-5-11-28(29)27-9-3-1-4-10-27/h1,3-6,9-16,32,36H,2,7-8,17-24H2,(H,33,37) |
| InChIKey | CYJRDSZEWRNBOR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|