C37H42N4O4 — CID 173196444
2-[[2-[4-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]acetyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate (PubChem CID 173196444) has the molecular formula C37H42N4O4 and a molecular weight of 606.77 g/mol. Its IUPAC name is 2-[[2-[4-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]acetyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate.
| Compound Name | 2-[[2-[4-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]acetyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate |
|---|---|
| PubChem CID | 173196444 |
| Molecular Formula | C37H42N4O4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | 2-[[2-[4-[[2-(4-hydroxyphenyl)ethylamino]methyl]phenyl]acetyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate |
| SMILES | O=C(Cc1ccc(CNCCc2ccc(O)cc2)cc1)NCCOC(=O)N(c1ccccc1-c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C37H42N4O4/c42-33-19-17-29(18-20-33)21-22-38-28-31-15-13-30(14-16-31)27-36(43)39-23-26-45-37(44)41(40-24-7-2-8-25-40)35-12-6-5-11-34(35)32-9-3-1-4-10-32/h1,3-6,9-20,38,42H,2,7-8,21-28H2,(H,39,43) |
| InChIKey | SMEOTIQSHNEFLZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|