C28H32N4O3 — CID 173183282
2-[[4-(aminomethyl)benzoyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate (PubChem CID 173183282) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)benzoyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate.
| Compound Name | 2-[[4-(aminomethyl)benzoyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate |
|---|---|
| PubChem CID | 173183282 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 2-[[4-(aminomethyl)benzoyl]amino]ethyl N-(2-phenylphenyl)-N-piperidin-1-ylcarbamate |
| SMILES | NCc1ccc(C(=O)NCCOC(=O)N(c2ccccc2-c2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H32N4O3/c29-21-22-13-15-24(16-14-22)27(33)30-17-20-35-28(34)32(31-18-7-2-8-19-31)26-12-6-5-11-25(26)23-9-3-1-4-10-23/h1,3-6,9-16H,2,7-8,17-21,29H2,(H,30,33) |
| InChIKey | KOXCMHQIEBWOPV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|