C26H33N3O3 — CID 173143161
2-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-5-ethoxy-3-methylbenzamide (PubChem CID 173143161) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-5-ethoxy-3-methylbenzamide.
| Compound Name | 2-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-5-ethoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 173143161 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-5-ethoxy-3-methylbenzamide |
| SMILES | CCOc1cc(C)c(C(=O)N2CC3CN(CCCc4ccccc4)C[C@H]3C2)c(C(N)=O)c1 |
| InChI | InChI=1S/C26H33N3O3/c1-3-32-22-12-18(2)24(23(13-22)25(27)30)26(31)29-16-20-14-28(15-21(20)17-29)11-7-10-19-8-5-4-6-9-19/h4-6,8-9,12-13,20-21H,3,7,10-11,14-17H2,1-2H3,(H2,27,30)/t20-,21?/m0/s1 |
| InChIKey | OURUGZFCJHBDCY-BGERDNNASA-N |
| XLogP | 3.13 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |