C20H29N3O2 — CID 173143227
4-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methyl-4-oxobutanamide (PubChem CID 173143227) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 4-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methyl-4-oxobutanamide.
| Compound Name | 4-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 173143227 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 4-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-methyl-4-oxobutanamide |
| SMILES | CC(CC(=O)N1CC2CN(CCCc3ccccc3)C[C@H]2C1)C(N)=O |
| InChI | InChI=1S/C20H29N3O2/c1-15(20(21)25)10-19(24)23-13-17-11-22(12-18(17)14-23)9-5-8-16-6-3-2-4-7-16/h2-4,6-7,15,17-18H,5,8-14H2,1H3,(H2,21,25)/t15?,17-,18?/m0/s1 |
| InChIKey | YCBHQLFYVABLQE-NXYGQSRBSA-N |
| XLogP | 1.52 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |