C25H31N3O2 — CID 173143290
2-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3,5-dimethylbenzamide (PubChem CID 173143290) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3,5-dimethylbenzamide.
| Compound Name | 2-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 173143290 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-[(3aS)-2-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)N2CC3CN(CCCc4ccccc4)C[C@H]3C2)c(C(N)=O)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-17-11-18(2)23(22(12-17)24(26)29)25(30)28-15-20-13-27(14-21(20)16-28)10-6-9-19-7-4-3-5-8-19/h3-5,7-8,11-12,20-21H,6,9-10,13-16H2,1-2H3,(H2,26,29)/t20-,21?/m0/s1 |
| InChIKey | RBGYGDDDFBQOFU-BGERDNNASA-N |
| XLogP | 3.04 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |