C18H21NO — CID 173144085
4-butoxy-5-naphthalen-1-yl-2,3-dihydro-1H-pyrrole (PubChem CID 173144085) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-butoxy-5-naphthalen-1-yl-2,3-dihydro-1H-pyrrole.
| Compound Name | 4-butoxy-5-naphthalen-1-yl-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 173144085 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-butoxy-5-naphthalen-1-yl-2,3-dihydro-1H-pyrrole |
| SMILES | CCCCOC1=C(c2cccc3ccccc23)NCC1 |
| InChI | InChI=1S/C18H21NO/c1-2-3-13-20-17-11-12-19-18(17)16-10-6-8-14-7-4-5-9-15(14)16/h4-10,19H,2-3,11-13H2,1H3 |
| InChIKey | ZOYRGRBBQDCBQH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|