C20H31N3O3 — CID 173146859
[4-[3-(4-cyclohexylbutanoylamino)propylamino]phenyl] carbamate (PubChem CID 173146859) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is [4-[3-(4-cyclohexylbutanoylamino)propylamino]phenyl] carbamate.
| Compound Name | [4-[3-(4-cyclohexylbutanoylamino)propylamino]phenyl] carbamate |
|---|---|
| PubChem CID | 173146859 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | [4-[3-(4-cyclohexylbutanoylamino)propylamino]phenyl] carbamate |
| SMILES | NC(=O)Oc1ccc(NCCCNC(=O)CCCC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H31N3O3/c21-20(25)26-18-12-10-17(11-13-18)22-14-5-15-23-19(24)9-4-8-16-6-2-1-3-7-16/h10-13,16,22H,1-9,14-15H2,(H2,21,25)(H,23,24) |
| InChIKey | UWRGZSMIJIMJKK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|