C17H21N5 — CID 173151036
2-[1-(2-pyrrolidin-2-yl-3-pyridinyl)pyrrolidin-2-yl]pyrazine (PubChem CID 173151036) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-[1-(2-pyrrolidin-2-yl-3-pyridinyl)pyrrolidin-2-yl]pyrazine.
| Compound Name | 2-[1-(2-pyrrolidin-2-yl-3-pyridinyl)pyrrolidin-2-yl]pyrazine |
|---|---|
| PubChem CID | 173151036 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[1-(2-pyrrolidin-2-yl-3-pyridinyl)pyrrolidin-2-yl]pyrazine |
| SMILES | c1cnc(C2CCCN2)c(N2CCCC2c2cnccn2)c1 |
| InChI | InChI=1S/C17H21N5/c1-4-13(19-7-1)17-16(5-2-8-21-17)22-11-3-6-15(22)14-12-18-9-10-20-14/h2,5,8-10,12-13,15,19H,1,3-4,6-7,11H2 |
| InChIKey | HZMJTFLDSGPXKV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |