C23H28FN5O — CID 173152229
3-amino-4-(2-fluorophenyl)-1-[2-(1-hepta-1,3,5-trien-4-yltriazol-4-yl)pyrrolidin-1-yl]butan-1-one (PubChem CID 173152229) has the molecular formula C23H28FN5O and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-amino-4-(2-fluorophenyl)-1-[2-(1-hepta-1,3,5-trien-4-yltriazol-4-yl)pyrrolidin-1-yl]butan-1-one.
| Compound Name | 3-amino-4-(2-fluorophenyl)-1-[2-(1-hepta-1,3,5-trien-4-yltriazol-4-yl)pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 173152229 |
| Molecular Formula | C23H28FN5O |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 3-amino-4-(2-fluorophenyl)-1-[2-(1-hepta-1,3,5-trien-4-yltriazol-4-yl)pyrrolidin-1-yl]butan-1-one |
| SMILES | C=CC=C(C=CC)n1cc(C2CCCN2C(=O)CC(N)Cc2ccccc2F)nn1 |
| InChI | InChI=1S/C23H28FN5O/c1-3-8-19(9-4-2)29-16-21(26-27-29)22-12-7-13-28(22)23(30)15-18(25)14-17-10-5-6-11-20(17)24/h3-6,8-11,16,18,22H,1,7,12-15,25H2,2H3 |
| InChIKey | XUWPDJTUBWDXFO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|