C24H28FN3O2 — CID 173152505
3-amino-4-(2-fluorophenyl)-1-[2-(4-hepta-1,3,5-trien-4-yl-1,3-oxazol-2-yl)pyrrolidin-1-yl]butan-1-one (PubChem CID 173152505) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-amino-4-(2-fluorophenyl)-1-[2-(4-hepta-1,3,5-trien-4-yl-1,3-oxazol-2-yl)pyrrolidin-1-yl]butan-1-one.
| Compound Name | 3-amino-4-(2-fluorophenyl)-1-[2-(4-hepta-1,3,5-trien-4-yl-1,3-oxazol-2-yl)pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 173152505 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 3-amino-4-(2-fluorophenyl)-1-[2-(4-hepta-1,3,5-trien-4-yl-1,3-oxazol-2-yl)pyrrolidin-1-yl]butan-1-one |
| SMILES | C=CC=C(C=CC)c1coc(C2CCCN2C(=O)CC(N)Cc2ccccc2F)n1 |
| InChI | InChI=1S/C24H28FN3O2/c1-3-8-17(9-4-2)21-16-30-24(27-21)22-12-7-13-28(22)23(29)15-19(26)14-18-10-5-6-11-20(18)25/h3-6,8-11,16,19,22H,1,7,12-15,26H2,2H3 |
| InChIKey | LXTJBBPJPXTMAQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|