C24H30FN5O3 — CID 173152342
3-amino-4-(2-fluorophenyl)-1-[2-(1-hepta-1,3,5-trien-4-yl-1,2,4-triazol-3-yl)pyrrolidin-1-yl]butan-1-one;formic acid (PubChem CID 173152342) has the molecular formula C24H30FN5O3 and a molecular weight of 455.53 g/mol. Its IUPAC name is 3-amino-4-(2-fluorophenyl)-1-[2-(1-hepta-1,3,5-trien-4-yl-1,2,4-triazol-3-yl)pyrrolidin-1-yl]butan-1-one;formic acid.
| Compound Name | 3-amino-4-(2-fluorophenyl)-1-[2-(1-hepta-1,3,5-trien-4-yl-1,2,4-triazol-3-yl)pyrrolidin-1-yl]butan-1-one;formic acid |
|---|---|
| PubChem CID | 173152342 |
| Molecular Formula | C24H30FN5O3 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 3-amino-4-(2-fluorophenyl)-1-[2-(1-hepta-1,3,5-trien-4-yl-1,2,4-triazol-3-yl)pyrrolidin-1-yl]butan-1-one;formic acid |
| SMILES | C=CC=C(C=CC)n1cnc(C2CCCN2C(=O)CC(N)Cc2ccccc2F)n1.O=CO |
| InChI | InChI=1S/C23H28FN5O.CH2O2/c1-3-8-19(9-4-2)29-16-26-23(27-29)21-12-7-13-28(21)22(30)15-18(25)14-17-10-5-6-11-20(17)24;2-1-3/h3-6,8-11,16,18,21H,1,7,12-15,25H2,2H3;1H,(H,2,3) |
| InChIKey | LKPWKSQSZLQMDZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|