C25H31FN4O3 — CID 87755752
(3R)-3-amino-4-(2-fluorophenyl)-1-[(2S)-2-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one;formic acid (PubChem CID 87755752) has the molecular formula C25H31FN4O3 and a molecular weight of 454.55 g/mol. Its IUPAC name is (3R)-3-amino-4-(2-fluorophenyl)-1-[(2S)-2-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one;formic acid.
| Compound Name | (3R)-3-amino-4-(2-fluorophenyl)-1-[(2S)-2-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one;formic acid |
|---|---|
| PubChem CID | 87755752 |
| Molecular Formula | C25H31FN4O3 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (3R)-3-amino-4-(2-fluorophenyl)-1-[(2S)-2-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-imidazol-2-yl]pyrrolidin-1-yl]butan-1-one;formic acid |
| SMILES | C=C/C=C(\C=C/C)c1cnc([C@@H]2CCCN2C(=O)C[C@H](N)Cc2ccccc2F)[nH]1.O=CO |
| InChI | InChI=1S/C24H29FN4O.CH2O2/c1-3-8-17(9-4-2)21-16-27-24(28-21)22-12-7-13-29(22)23(30)15-19(26)14-18-10-5-6-11-20(18)25;2-1-3/h3-6,8-11,16,19,22H,1,7,12-15,26H2,2H3,(H,27,28);1H,(H,2,3)/b9-4-,17-8+;/t19-,22+;/m1./s1 |
| InChIKey | QSKLSRLCQXLRKO-BXIWXSJSSA-N |
| XLogP | 4.02 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|