C24H27N3O5 — CID 173152671
[3-(hydroxyamino)-3-hydroxyiminopropyl]-[[6-(3-phenylpropoxy)naphthalen-2-yl]methyl]carbamic acid (PubChem CID 173152671) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is [3-(hydroxyamino)-3-hydroxyiminopropyl]-[[6-(3-phenylpropoxy)naphthalen-2-yl]methyl]carbamic acid.
| Compound Name | [3-(hydroxyamino)-3-hydroxyiminopropyl]-[[6-(3-phenylpropoxy)naphthalen-2-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 173152671 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [3-(hydroxyamino)-3-hydroxyiminopropyl]-[[6-(3-phenylpropoxy)naphthalen-2-yl]methyl]carbamic acid |
| SMILES | O=C(O)N(CCC(=NO)NO)Cc1ccc2cc(OCCCc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C24H27N3O5/c28-24(29)27(13-12-23(25-30)26-31)17-19-8-9-21-16-22(11-10-20(21)15-19)32-14-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-11,15-16,30-31H,4,7,12-14,17H2,(H,25,26)(H,28,29) |
| InChIKey | HEFBYOPBUNEWFT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|