C27H25NO7 — CID 173156043
4-(hexylamino)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid (PubChem CID 173156043) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is 4-(hexylamino)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid.
| Compound Name | 4-(hexylamino)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
|---|---|
| PubChem CID | 173156043 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-(hexylamino)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| SMILES | CCCCCCNc1c(C(=O)O)ccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C27H25NO7/c1-2-3-4-5-12-28-24-17(25(31)32)8-11-20-23(24)26(33)35-27(20)18-9-6-15(29)13-21(18)34-22-14-16(30)7-10-19(22)27/h6-11,13-14,28-30H,2-5,12H2,1H3,(H,31,32) |
| InChIKey | LGDWRCYKDHOVSD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|