About dimethyl(3-phenylpropyl)phosphane;hydrobromide
dimethyl(3-phenylpropyl)phosphane;hydrobromide (PubChem CID 173157759) has the molecular formula C11H18BrP
and a molecular weight of 261.14 g/mol. Its IUPAC name is dimethyl(3-phenylpropyl)phosphane;hydrobromide.
Molecular Properties
| Compound Name | dimethyl(3-phenylpropyl)phosphane;hydrobromide |
| PubChem CID | 173157759 |
| Molecular Formula | C11H18BrP |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | dimethyl(3-phenylpropyl)phosphane;hydrobromide |
| SMILES | Br.CP(C)CCCc1ccccc1 |
| InChI | InChI=1S/C11H17P.BrH/c1-12(2)10-6-9-11-7-4-3-5-8-11;/h3-5,7-8H,6,9-10H2,1-2H3;1H |
| InChIKey | HXDBKDXHMXNMBU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(3-phenylpropyl)phosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(3-phenylpropyl)phosphane;hydrobromide?
The IUPAC name of dimethyl(3-phenylpropyl)phosphane;hydrobromide (CID 173157759) is dimethyl(3-phenylpropyl)phosphane;hydrobromide.
What is the SMILES notation for dimethyl(3-phenylpropyl)phosphane;hydrobromide?
The canonical SMILES for dimethyl(3-phenylpropyl)phosphane;hydrobromide is Br.CP(C)CCCc1ccccc1.
What is the InChIKey of dimethyl(3-phenylpropyl)phosphane;hydrobromide?
The InChIKey is HXDBKDXHMXNMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17P.BrH/c1-12(2)10-6-9-11-7-4-3-5-8-11;/h3-5,7-8H,6,9-10H2,1-2H3;1H.
What are the key properties of dimethyl(3-phenylpropyl)phosphane;hydrobromide?
dimethyl(3-phenylpropyl)phosphane;hydrobromide has a molecular weight of 261.14 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(3-phenylpropyl)phosphane;hydrobromide is sourced from PubChem (CID 173157759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).