C9H16N2O — CID 173158991
N-butyl-4-ethyl-1,3-oxazol-5-amine (PubChem CID 173158991) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-butyl-4-ethyl-1,3-oxazol-5-amine.
| Compound Name | N-butyl-4-ethyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 173158991 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-butyl-4-ethyl-1,3-oxazol-5-amine |
| SMILES | CCCCNc1ocnc1CC |
| InChI | InChI=1S/C9H16N2O/c1-3-5-6-10-9-8(4-2)11-7-12-9/h7,10H,3-6H2,1-2H3 |
| InChIKey | WCQRANDJEWOWFJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|