C24H23ClN2O3 — CID 173160189
3-(5-chloro-8-hydroxyquinolin-7-yl)-3-(cyclohexen-1-yl)-2-phenoxypropanamide (PubChem CID 173160189) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is 3-(5-chloro-8-hydroxyquinolin-7-yl)-3-(cyclohexen-1-yl)-2-phenoxypropanamide.
| Compound Name | 3-(5-chloro-8-hydroxyquinolin-7-yl)-3-(cyclohexen-1-yl)-2-phenoxypropanamide |
|---|---|
| PubChem CID | 173160189 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 3-(5-chloro-8-hydroxyquinolin-7-yl)-3-(cyclohexen-1-yl)-2-phenoxypropanamide |
| SMILES | NC(=O)C(Oc1ccccc1)C(C1=CCCCC1)c1cc(Cl)c2cccnc2c1O |
| InChI | InChI=1S/C24H23ClN2O3/c25-19-14-18(22(28)21-17(19)12-7-13-27-21)20(15-8-3-1-4-9-15)23(24(26)29)30-16-10-5-2-6-11-16/h2,5-8,10-14,20,23,28H,1,3-4,9H2,(H2,26,29) |
| InChIKey | VLGKLTNNTSJJFH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|