C8H11NO8P2 — CID 173165944
dihydroxy(oxo)phosphanium;hydroxy-[2-(4-nitrophenyl)ethyl]phosphinate (PubChem CID 173165944) has the molecular formula C8H11NO8P2 and a molecular weight of 311.12 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;hydroxy-[2-(4-nitrophenyl)ethyl]phosphinate.
| Compound Name | dihydroxy(oxo)phosphanium;hydroxy-[2-(4-nitrophenyl)ethyl]phosphinate |
|---|---|
| PubChem CID | 173165944 |
| Molecular Formula | C8H11NO8P2 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | dihydroxy(oxo)phosphanium;hydroxy-[2-(4-nitrophenyl)ethyl]phosphinate |
| SMILES | O=[N+]([O-])c1ccc(CCP(=O)([O-])O)cc1.O=[P+](O)O |
| InChI | InChI=1S/C8H10NO5P.HO3P/c10-9(11)8-3-1-7(2-4-8)5-6-15(12,13)14;1-4(2)3/h1-4H,5-6H2,(H2,12,13,14);(H-,1,2,3) |
| InChIKey | ODVYUNPFXAZPOZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 161.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|