C15H27NO4Si — CID 173171481
prop-2-enyl (2S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-oxopyrrolidine-1-carboxylate (PubChem CID 173171481) has the molecular formula C15H27NO4Si and a molecular weight of 313.47 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-oxopyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173171481 |
| Molecular Formula | C15H27NO4Si |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | prop-2-enyl (2S)-2-(1-dimethylsilyloxy-2,2-dimethylpropyl)-4-oxopyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(=O)C[C@H]1C(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C15H27NO4Si/c1-7-8-19-14(18)16-10-11(17)9-12(16)13(15(2,3)4)20-21(5)6/h7,12-13,21H,1,8-10H2,2-6H3/t12-,13?/m0/s1 |
| InChIKey | XJGICMYXCFBXTD-UEWDXFNNSA-N |
| XLogP | 2.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|