C19H37NO3Si — CID 149433135
methyl N-[(1S)-1-[4-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclohexyl]but-3-enyl]carbamate (PubChem CID 149433135) has the molecular formula C19H37NO3Si and a molecular weight of 355.60 g/mol. Its IUPAC name is methyl N-[(1S)-1-[4-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclohexyl]but-3-enyl]carbamate.
| Compound Name | methyl N-[(1S)-1-[4-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclohexyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 149433135 |
| Molecular Formula | C19H37NO3Si |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | methyl N-[(1S)-1-[4-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclohexyl]but-3-enyl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OC)C1CCC(C(O[SiH](C)C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H37NO3Si/c1-8-9-16(20-18(21)22-5)14-10-12-15(13-11-14)17(19(2,3)4)23-24(6)7/h8,14-17,24H,1,9-13H2,2-7H3,(H,20,21)/t14?,15?,16-,17?/m0/s1 |
| InChIKey | ISVKCMSKHRNWPN-PYCMUAIMSA-N |
| XLogP | 4.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|