C25H24N6OS — CID 173176127
(2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[[4-(piperazin-1-ylmethyl)phenyl]methoxy]pyrimidin-4-yl]acetonitrile (PubChem CID 173176127) has the molecular formula C25H24N6OS and a molecular weight of 456.58 g/mol. Its IUPAC name is (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[[4-(piperazin-1-ylmethyl)phenyl]methoxy]pyrimidin-4-yl]acetonitrile.
| Compound Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[[4-(piperazin-1-ylmethyl)phenyl]methoxy]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 173176127 |
| Molecular Formula | C25H24N6OS |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[[4-(piperazin-1-ylmethyl)phenyl]methoxy]pyrimidin-4-yl]acetonitrile |
| SMILES | N#C/C(=C1/Nc2ccccc2S1)c1ccnc(OCc2ccc(CN3CCNCC3)cc2)n1 |
| InChI | InChI=1S/C25H24N6OS/c26-15-20(24-29-22-3-1-2-4-23(22)33-24)21-9-10-28-25(30-21)32-17-19-7-5-18(6-8-19)16-31-13-11-27-12-14-31/h1-10,27,29H,11-14,16-17H2/b24-20+ |
| InChIKey | YUYHNOZOXALHSF-HIXSDJFHSA-N |
| XLogP | 3.87 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|