C16H32NO9P — CID 173178965
[1-[amino-(2-methyl-1-propoxycarbonyloxypropoxy)phosphoryl]oxy-2-methylpropyl] propyl carbonate (PubChem CID 173178965) has the molecular formula C16H32NO9P and a molecular weight of 413.40 g/mol. Its IUPAC name is [1-[amino-(2-methyl-1-propoxycarbonyloxypropoxy)phosphoryl]oxy-2-methylpropyl] propyl carbonate.
| Compound Name | [1-[amino-(2-methyl-1-propoxycarbonyloxypropoxy)phosphoryl]oxy-2-methylpropyl] propyl carbonate |
|---|---|
| PubChem CID | 173178965 |
| Molecular Formula | C16H32NO9P |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [1-[amino-(2-methyl-1-propoxycarbonyloxypropoxy)phosphoryl]oxy-2-methylpropyl] propyl carbonate |
| SMILES | CCCOC(=O)OC(OP(N)(=O)OC(OC(=O)OCCC)C(C)C)C(C)C |
| InChI | InChI=1S/C16H32NO9P/c1-7-9-21-15(18)23-13(11(3)4)25-27(17,20)26-14(12(5)6)24-16(19)22-10-8-2/h11-14H,7-10H2,1-6H3,(H2,17,20) |
| InChIKey | QVTKPUGUCRXQFF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|