C24H47N3O11P+ — CID 91339530
acetyloxy-[N'-bis(2-methyl-1-propoxycarbonyloxypropoxy)phosphorylcarbamimidoyl]-butyl-methylazanium (PubChem CID 91339530) has the molecular formula C24H47N3O11P+ and a molecular weight of 584.62 g/mol. Its IUPAC name is acetyloxy-[N'-bis(2-methyl-1-propoxycarbonyloxypropoxy)phosphorylcarbamimidoyl]-butyl-methylazanium.
| Compound Name | acetyloxy-[N'-bis(2-methyl-1-propoxycarbonyloxypropoxy)phosphorylcarbamimidoyl]-butyl-methylazanium |
|---|---|
| PubChem CID | 91339530 |
| Molecular Formula | C24H47N3O11P+ |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | acetyloxy-[N'-bis(2-methyl-1-propoxycarbonyloxypropoxy)phosphorylcarbamimidoyl]-butyl-methylazanium |
| SMILES | CCCC[N+](C)(OC(C)=O)C(N)=NP(=O)(OC(OC(=O)OCCC)C(C)C)OC(OC(=O)OCCC)C(C)C |
| InChI | InChI=1S/C24H47N3O11P/c1-10-13-14-27(9,36-19(8)28)22(25)26-39(31,37-20(17(4)5)34-23(29)32-15-11-2)38-21(18(6)7)35-24(30)33-16-12-3/h17-18,20-21H,10-16H2,1-9H3,(H2,25,26,31)/q+1 |
| InChIKey | FFYJDTQMYCQGJA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 171.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|