C23H37N3O11P+ — CID 91807467
acetyloxy-benzyl-[N'-[bis(2-propoxycarbonyloxyethoxy)phosphoryl]carbamimidoyl]-methylazanium (PubChem CID 91807467) has the molecular formula C23H37N3O11P+ and a molecular weight of 562.53 g/mol. Its IUPAC name is acetyloxy-benzyl-[N'-[bis(2-propoxycarbonyloxyethoxy)phosphoryl]carbamimidoyl]-methylazanium.
| Compound Name | acetyloxy-benzyl-[N'-[bis(2-propoxycarbonyloxyethoxy)phosphoryl]carbamimidoyl]-methylazanium |
|---|---|
| PubChem CID | 91807467 |
| Molecular Formula | C23H37N3O11P+ |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | acetyloxy-benzyl-[N'-[bis(2-propoxycarbonyloxyethoxy)phosphoryl]carbamimidoyl]-methylazanium |
| SMILES | CCCOC(=O)OCCOP(=O)(N=C(N)[N+](C)(Cc1ccccc1)OC(C)=O)OCCOC(=O)OCCC |
| InChI | InChI=1S/C23H37N3O11P/c1-5-12-31-22(28)33-14-16-35-38(30,36-17-15-34-23(29)32-13-6-2)25-21(24)26(4,37-19(3)27)18-20-10-8-7-9-11-20/h7-11H,5-6,12-18H2,1-4H3,(H2,24,25,30)/q+1 |
| InChIKey | RVGMKBDZFNBFIA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 171.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|