C24H44N2Na2O9S — CID 173181619
disodium;(Z)-N'-(2-hydroxyethyl)octadec-9-enehydrazide;2-sulfobutanedioate (PubChem CID 173181619) has the molecular formula C24H44N2Na2O9S and a molecular weight of 582.67 g/mol. Its IUPAC name is disodium;(Z)-N'-(2-hydroxyethyl)octadec-9-enehydrazide;2-sulfobutanedioate.
| Compound Name | disodium;(Z)-N'-(2-hydroxyethyl)octadec-9-enehydrazide;2-sulfobutanedioate |
|---|---|
| PubChem CID | 173181619 |
| Molecular Formula | C24H44N2Na2O9S |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | disodium;(Z)-N'-(2-hydroxyethyl)octadec-9-enehydrazide;2-sulfobutanedioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NNCCO.O=C([O-])CC(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C20H40N2O2.C4H6O7S.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)22-21-18-19-23;5-3(6)1-2(4(7)8)12(9,10)11;;/h9-10,21,23H,2-8,11-19H2,1H3,(H,22,24);2H,1H2,(H,5,6)(H,7,8)(H,9,10,11);;/q;;2*+1/p-2/b10-9-;;; |
| InChIKey | XGSSFDYABAYDJN-BZKIHGKGSA-L |
| XLogP | -5.22 |
| TPSA | 195.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | -5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|