C22H39NNa2O6S — CID 170848714
disodium;4-[(E)-octadec-9-enyl]imino-4-oxido-2-sulfobutanoate (PubChem CID 170848714) has the molecular formula C22H39NNa2O6S and a molecular weight of 491.60 g/mol. Its IUPAC name is disodium;4-[(E)-octadec-9-enyl]imino-4-oxido-2-sulfobutanoate.
| Compound Name | disodium;4-[(E)-octadec-9-enyl]imino-4-oxido-2-sulfobutanoate |
|---|---|
| PubChem CID | 170848714 |
| Molecular Formula | C22H39NNa2O6S |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | disodium;4-[(E)-octadec-9-enyl]imino-4-oxido-2-sulfobutanoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC/N=C(\[O-])CC(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C22H41NO6S.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-21(24)19-20(22(25)26)30(27,28)29;;/h9-10,20H,2-8,11-19H2,1H3,(H,23,24)(H,25,26)(H,27,28,29);;/q;2*+1/p-2/b10-9+;; |
| InChIKey | PLHAFYWVSVUQCQ-TTWKNDKESA-L |
| XLogP | -2.81 |
| TPSA | 129.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|