C11H22N2O3 — CID 173188453
5-amino-2-tert-butyl-5-hydroxyimino-3,3-dimethylpentanoic acid (PubChem CID 173188453) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-amino-2-tert-butyl-5-hydroxyimino-3,3-dimethylpentanoic acid.
| Compound Name | 5-amino-2-tert-butyl-5-hydroxyimino-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 173188453 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 5-amino-2-tert-butyl-5-hydroxyimino-3,3-dimethylpentanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(C)(C)CC(N)=NO |
| InChI | InChI=1S/C11H22N2O3/c1-10(2,3)8(9(14)15)11(4,5)6-7(12)13-16/h8,16H,6H2,1-5H3,(H2,12,13)(H,14,15) |
| InChIKey | ZWXBFZHVQDFBTQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|