C6H16ClNO10 — CID 173190602
CID 173190602 (PubChem CID 173190602) has the molecular formula C6H16ClNO10 and a molecular weight of 297.64 g/mol.
| Compound Name | CID 173190602 |
|---|---|
| PubChem CID | 173190602 |
| Molecular Formula | C6H16ClNO10 |
| Molecular Weight | 297.64 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | — |
| SMILES | OCCON(OCCO)OCCO.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C6H15NO6.ClHO4/c8-1-4-11-7(12-5-2-9)13-6-3-10;2-1(3,4)5/h8-10H,1-6H2;(H,2,3,4,5) |
| InChIKey | WBYCCWVZXVVABY-UHFFFAOYSA-N |
| XLogP | -6.06 |
| TPSA | 181.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.64 |
| LogP ≤ 5 | -6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|