2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid

C7H17NO9 — CID 87903957

IUPAC2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid
SMILESO=C(O)O.OCCON(OCCO)OCCO
InChIInChI=1S/C6H15NO6.CH2O3/c8-1-4-11-7(12-5-2-9)13-6-3-10;2-1(3)4/h8-10H,1-6H2;(H2,2,3,4)
InChIKeyFARGLKFCRFIXEJ-UHFFFAOYSA-N
MW259.21 g/mol
LogP-1.72
Rot. Bonds9

About 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid

2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid (PubChem CID 87903957) has the molecular formula C7H17NO9 and a molecular weight of 259.21 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid.

Molecular Properties

Compound Name2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid
PubChem CID87903957
Molecular FormulaC7H17NO9
Molecular Weight259.21 g/mol
Exact Mass259.09
IUPAC Name2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid
SMILESO=C(O)O.OCCON(OCCO)OCCO
InChIInChI=1S/C6H15NO6.CH2O3/c8-1-4-11-7(12-5-2-9)13-6-3-10;2-1(3)4/h8-10H,1-6H2;(H2,2,3,4)
InChIKeyFARGLKFCRFIXEJ-UHFFFAOYSA-N
XLogP-1.72
TPSA149.15 Ų
H-Bond Donors5
H-Bond Acceptors8
Rotatable Bonds9
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.21
LogP ≤ 5-1.72
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid?
The IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid (CID 87903957) is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid.
What is the SMILES notation for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid?
The canonical SMILES for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid is O=C(O)O.OCCON(OCCO)OCCO.
What is the InChIKey of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid?
The InChIKey is FARGLKFCRFIXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO6.CH2O3/c8-1-4-11-7(12-5-2-9)13-6-3-10;2-1(3)4/h8-10H,1-6H2;(H2,2,3,4).
What are the key properties of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid?
2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid has a molecular weight of 259.21 g/mol, XLogP of -1.72, 9 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid is sourced from PubChem (CID 87903957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).