About 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid
2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid (PubChem CID 87903957) has the molecular formula C7H17NO9
and a molecular weight of 259.21 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid |
| PubChem CID | 87903957 |
| Molecular Formula | C7H17NO9 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid |
| SMILES | O=C(O)O.OCCON(OCCO)OCCO |
| InChI | InChI=1S/C6H15NO6.CH2O3/c8-1-4-11-7(12-5-2-9)13-6-3-10;2-1(3)4/h8-10H,1-6H2;(H2,2,3,4) |
| InChIKey | FARGLKFCRFIXEJ-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid?
The IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid (CID 87903957) is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid.
What is the SMILES notation for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid?
The canonical SMILES for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid is O=C(O)O.OCCON(OCCO)OCCO.
What is the InChIKey of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid?
The InChIKey is FARGLKFCRFIXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO6.CH2O3/c8-1-4-11-7(12-5-2-9)13-6-3-10;2-1(3)4/h8-10H,1-6H2;(H2,2,3,4).
What are the key properties of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid?
2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid has a molecular weight of 259.21 g/mol, XLogP of -1.72, 9 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;carbonic acid is sourced from PubChem (CID 87903957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).