About 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid
2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid (PubChem CID 87739417) has the molecular formula C9H19NO10
and a molecular weight of 301.25 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid |
| PubChem CID | 87739417 |
| Molecular Formula | C9H19NO10 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid |
| SMILES | O=C(O)CC(=O)O.OCCON(OCCO)OCCO |
| InChI | InChI=1S/C6H15NO6.C3H4O4/c8-1-4-11-7(12-5-2-9)13-6-3-10;4-2(5)1-3(6)7/h8-10H,1-6H2;1H2,(H,4,5)(H,6,7) |
| InChIKey | WDPICVVUJUJNQP-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 166.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid?
The IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid (CID 87739417) is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid.
What is the SMILES notation for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid?
The canonical SMILES for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid is O=C(O)CC(=O)O.OCCON(OCCO)OCCO.
What is the InChIKey of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid?
The InChIKey is WDPICVVUJUJNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO6.C3H4O4/c8-1-4-11-7(12-5-2-9)13-6-3-10;4-2(5)1-3(6)7/h8-10H,1-6H2;1H2,(H,4,5)(H,6,7).
What are the key properties of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid?
2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid has a molecular weight of 301.25 g/mol, XLogP of -2.39, 11 rotatable bonds, 5 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;propanedioic acid is sourced from PubChem (CID 87739417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).