C37H38O2Si — CID 173198394
bis[4-(4-methoxyphenyl)-2-methyl-1,4-dihydroazulen-1-yl]-methylsilane (PubChem CID 173198394) has the molecular formula C37H38O2Si and a molecular weight of 542.80 g/mol. Its IUPAC name is bis[4-(4-methoxyphenyl)-2-methyl-1,4-dihydroazulen-1-yl]-methylsilane.
| Compound Name | bis[4-(4-methoxyphenyl)-2-methyl-1,4-dihydroazulen-1-yl]-methylsilane |
|---|---|
| PubChem CID | 173198394 |
| Molecular Formula | C37H38O2Si |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | bis[4-(4-methoxyphenyl)-2-methyl-1,4-dihydroazulen-1-yl]-methylsilane |
| SMILES | COc1ccc(C2C=CC=CC3=C2C=C(C)C3[SiH](C)C2C(C)=CC3=C2C=CC=CC3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H38O2Si/c1-24-22-34-30(26-14-18-28(38-3)19-15-26)10-6-8-12-32(34)36(24)40(5)37-25(2)23-35-31(11-7-9-13-33(35)37)27-16-20-29(39-4)21-17-27/h6-23,30-31,36-37,40H,1-5H3 |
| InChIKey | LWRLAWPQFBLAMO-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|