C10H24O2Si — CID 173198479
dimethoxy(2,2,3-trimethylpentan-3-yl)silane (PubChem CID 173198479) has the molecular formula C10H24O2Si and a molecular weight of 204.39 g/mol. Its IUPAC name is dimethoxy(2,2,3-trimethylpentan-3-yl)silane.
| Compound Name | dimethoxy(2,2,3-trimethylpentan-3-yl)silane |
|---|---|
| PubChem CID | 173198479 |
| Molecular Formula | C10H24O2Si |
| Molecular Weight | 204.39 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | dimethoxy(2,2,3-trimethylpentan-3-yl)silane |
| SMILES | CCC(C)([SiH](OC)OC)C(C)(C)C |
| InChI | InChI=1S/C10H24O2Si/c1-8-10(5,9(2,3)4)13(11-6)12-7/h13H,8H2,1-7H3 |
| InChIKey | UDUJMVMJZLIKEC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|