C10H28O3Si3 — CID 154118898
2-bis(trimethylsilyloxy)silylbutan-2-ol (PubChem CID 154118898) has the molecular formula C10H28O3Si3 and a molecular weight of 280.59 g/mol. Its IUPAC name is 2-bis(trimethylsilyloxy)silylbutan-2-ol.
| Compound Name | 2-bis(trimethylsilyloxy)silylbutan-2-ol |
|---|---|
| PubChem CID | 154118898 |
| Molecular Formula | C10H28O3Si3 |
| Molecular Weight | 280.59 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-bis(trimethylsilyloxy)silylbutan-2-ol |
| SMILES | CCC(C)(O)[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H28O3Si3/c1-9-10(2,11)14(12-15(3,4)5)13-16(6,7)8/h11,14H,9H2,1-8H3 |
| InChIKey | WOJDIRFKMAPNEM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|