C21H42O5Si — CID 173199777
methyl 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2-methyl-2-octyl-1,3-dioxolane-4-carboxylate (PubChem CID 173199777) has the molecular formula C21H42O5Si and a molecular weight of 402.65 g/mol. Its IUPAC name is methyl 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2-methyl-2-octyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2-methyl-2-octyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 173199777 |
| Molecular Formula | C21H42O5Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | methyl 5-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2-methyl-2-octyl-1,3-dioxolane-4-carboxylate |
| SMILES | CCCCCCCCC1(C)OC(C(=O)OC)C(C(O[SiH](C)C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H42O5Si/c1-9-10-11-12-13-14-15-21(5)24-16(17(25-21)19(22)23-6)18(20(2,3)4)26-27(7)8/h16-18,27H,9-15H2,1-8H3 |
| InChIKey | WAVVPYOZMGPHBR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|