C15H30FNO4Si — CID 11845899
methyl (4R,5S)-3-fluoro-3-hexyl-4-methyl-2-trimethylsilyloxy-1,2-oxazolidine-5-carboxylate (PubChem CID 11845899) has the molecular formula C15H30FNO4Si and a molecular weight of 335.49 g/mol. Its IUPAC name is methyl (4R,5S)-3-fluoro-3-hexyl-4-methyl-2-trimethylsilyloxy-1,2-oxazolidine-5-carboxylate.
| Compound Name | methyl (4R,5S)-3-fluoro-3-hexyl-4-methyl-2-trimethylsilyloxy-1,2-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 11845899 |
| Molecular Formula | C15H30FNO4Si |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | methyl (4R,5S)-3-fluoro-3-hexyl-4-methyl-2-trimethylsilyloxy-1,2-oxazolidine-5-carboxylate |
| SMILES | CCCCCCC1(F)[C@H](C)[C@@H](C(=O)OC)ON1O[Si](C)(C)C |
| InChI | InChI=1S/C15H30FNO4Si/c1-7-8-9-10-11-15(16)12(2)13(14(18)19-3)20-17(15)21-22(4,5)6/h12-13H,7-11H2,1-6H3/t12-,13+,15?/m1/s1 |
| InChIKey | GJRAIAMJBQFBBQ-NEJHNUGDSA-N |
| XLogP | 3.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|