C15H9F21N2O3S — CID 173199917
3-(3,3,4,4-tetrafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-imidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 173199917) has the molecular formula C15H9F21N2O3S and a molecular weight of 696.27 g/mol. Its IUPAC name is 3-(3,3,4,4-tetrafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-imidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 3-(3,3,4,4-tetrafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-imidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 173199917 |
| Molecular Formula | C15H9F21N2O3S |
| Molecular Weight | 696.27 g/mol |
| Exact Mass | 696.00 |
| IUPAC Name | 3-(3,3,4,4-tetrafluorobutyl)-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-imidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | FC(F)C(F)(F)CC[n+]1cc[nH]c1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C13H7F17N2.C2H2F4O3S/c14-5(15)7(16,17)1-3-32-4-2-31-6(32)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30;3-1(4)2(5,6)10(7,8)9/h2,4-5H,1,3H2;1H,(H,7,8,9) |
| InChIKey | NUMAHZUVZWGPMZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.27 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|