About 1-(3-methylbutoxy)ethyl formate
1-(3-methylbutoxy)ethyl formate (PubChem CID 173200690) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 1-(3-methylbutoxy)ethyl formate.
Molecular Properties
| Compound Name | 1-(3-methylbutoxy)ethyl formate |
| PubChem CID | 173200690 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 1-(3-methylbutoxy)ethyl formate |
| SMILES | CC(C)CCOC(C)OC=O |
| InChI | InChI=1S/C8H16O3/c1-7(2)4-5-10-8(3)11-6-9/h6-8H,4-5H2,1-3H3 |
| InChIKey | WEONEBDSHFHZKZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methylbutoxy)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylbutoxy)ethyl formate?
The IUPAC name of 1-(3-methylbutoxy)ethyl formate (CID 173200690) is 1-(3-methylbutoxy)ethyl formate.
What is the SMILES notation for 1-(3-methylbutoxy)ethyl formate?
The canonical SMILES for 1-(3-methylbutoxy)ethyl formate is CC(C)CCOC(C)OC=O.
What is the InChIKey of 1-(3-methylbutoxy)ethyl formate?
The InChIKey is WEONEBDSHFHZKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-7(2)4-5-10-8(3)11-6-9/h6-8H,4-5H2,1-3H3.
What are the key properties of 1-(3-methylbutoxy)ethyl formate?
1-(3-methylbutoxy)ethyl formate has a molecular weight of 160.21 g/mol, XLogP of 1.57, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylbutoxy)ethyl formate is sourced from PubChem (CID 173200690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).