About 2-(3-methylbutoxy)butyl formate
2-(3-methylbutoxy)butyl formate (PubChem CID 58489169) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(3-methylbutoxy)butyl formate.
Molecular Properties
| Compound Name | 2-(3-methylbutoxy)butyl formate |
| PubChem CID | 58489169 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 2-(3-methylbutoxy)butyl formate |
| SMILES | CCC(COC=O)OCCC(C)C |
| InChI | InChI=1S/C10H20O3/c1-4-10(7-12-8-11)13-6-5-9(2)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | IUEGYOMZRCLWCP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbutoxy)butyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbutoxy)butyl formate?
The IUPAC name of 2-(3-methylbutoxy)butyl formate (CID 58489169) is 2-(3-methylbutoxy)butyl formate.
What is the SMILES notation for 2-(3-methylbutoxy)butyl formate?
The canonical SMILES for 2-(3-methylbutoxy)butyl formate is CCC(COC=O)OCCC(C)C.
What is the InChIKey of 2-(3-methylbutoxy)butyl formate?
The InChIKey is IUEGYOMZRCLWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-4-10(7-12-8-11)13-6-5-9(2)3/h8-10H,4-7H2,1-3H3.
What are the key properties of 2-(3-methylbutoxy)butyl formate?
2-(3-methylbutoxy)butyl formate has a molecular weight of 188.27 g/mol, XLogP of 2.00, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbutoxy)butyl formate is sourced from PubChem (CID 58489169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).