C22H42O4Pb — CID 173200803
λ2-plumbane;bis(2,2,5-trimethyloctane-3,4-dione) (PubChem CID 173200803) has the molecular formula C22H42O4Pb and a molecular weight of 577.77 g/mol. Its IUPAC name is λ2-plumbane;bis(2,2,5-trimethyloctane-3,4-dione).
| Compound Name | λ2-plumbane;bis(2,2,5-trimethyloctane-3,4-dione) |
|---|---|
| PubChem CID | 173200803 |
| Molecular Formula | C22H42O4Pb |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | λ2-plumbane;bis(2,2,5-trimethyloctane-3,4-dione) |
| SMILES | CCCC(C)C(=O)C(=O)C(C)(C)C.CCCC(C)C(=O)C(=O)C(C)(C)C.[PbH2] |
| InChI | InChI=1S/2C11H20O2.Pb.2H/c2*1-6-7-8(2)9(12)10(13)11(3,4)5;;;/h2*8H,6-7H2,1-5H3;;; |
| InChIKey | QWBNDWNEKRWHPA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|