C8H15N4OS- — CID 173201614
2-[2-(2-ethyl-2-oxidohydrazinyl)ethyl]-1,3-thiazolidine-2-carbonitrile (PubChem CID 173201614) has the molecular formula C8H15N4OS- and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-[2-(2-ethyl-2-oxidohydrazinyl)ethyl]-1,3-thiazolidine-2-carbonitrile.
| Compound Name | 2-[2-(2-ethyl-2-oxidohydrazinyl)ethyl]-1,3-thiazolidine-2-carbonitrile |
|---|---|
| PubChem CID | 173201614 |
| Molecular Formula | C8H15N4OS- |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2-[2-(2-ethyl-2-oxidohydrazinyl)ethyl]-1,3-thiazolidine-2-carbonitrile |
| SMILES | CCN([O-])NCCC1(C#N)NCCS1 |
| InChI | InChI=1S/C8H15N4OS/c1-2-12(13)11-4-3-8(7-9)10-5-6-14-8/h10-11H,2-6H2,1H3/q-1 |
| InChIKey | OFYPETAFOUAQMB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|