C26H26Cl2N2O3 — CID 173202765
ethyl 1-[(E)-3-[2,3-dichloro-6-(1-methylindol-5-yl)phenyl]prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 173202765) has the molecular formula C26H26Cl2N2O3 and a molecular weight of 485.41 g/mol. Its IUPAC name is ethyl 1-[(E)-3-[2,3-dichloro-6-(1-methylindol-5-yl)phenyl]prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(E)-3-[2,3-dichloro-6-(1-methylindol-5-yl)phenyl]prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 173202765 |
| Molecular Formula | C26H26Cl2N2O3 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | ethyl 1-[(E)-3-[2,3-dichloro-6-(1-methylindol-5-yl)phenyl]prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)/C=C/c2c(-c3ccc4c(ccn4C)c3)ccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C26H26Cl2N2O3/c1-3-33-26(32)17-11-14-30(15-12-17)24(31)9-6-21-20(5-7-22(27)25(21)28)18-4-8-23-19(16-18)10-13-29(23)2/h4-10,13,16-17H,3,11-12,14-15H2,1-2H3/b9-6+ |
| InChIKey | PCFYZBLPSNQEFL-RMKNXTFCSA-N |
| XLogP | 5.97 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|