C26H28Cl2N2O4 — CID 173225871
1-[3-[3,4-dichloro-2-[(E)-3-(4-hydroxypiperidin-1-yl)-3-oxoprop-1-enyl]phenyl]phenyl]piperidine-4-carboxylic acid (PubChem CID 173225871) has the molecular formula C26H28Cl2N2O4 and a molecular weight of 503.43 g/mol. Its IUPAC name is 1-[3-[3,4-dichloro-2-[(E)-3-(4-hydroxypiperidin-1-yl)-3-oxoprop-1-enyl]phenyl]phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[3,4-dichloro-2-[(E)-3-(4-hydroxypiperidin-1-yl)-3-oxoprop-1-enyl]phenyl]phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 173225871 |
| Molecular Formula | C26H28Cl2N2O4 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 1-[3-[3,4-dichloro-2-[(E)-3-(4-hydroxypiperidin-1-yl)-3-oxoprop-1-enyl]phenyl]phenyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2cccc(-c3ccc(Cl)c(Cl)c3/C=C/C(=O)N3CCC(O)CC3)c2)CC1 |
| InChI | InChI=1S/C26H28Cl2N2O4/c27-23-6-4-21(22(25(23)28)5-7-24(32)30-14-10-20(31)11-15-30)18-2-1-3-19(16-18)29-12-8-17(9-13-29)26(33)34/h1-7,16-17,20,31H,8-15H2,(H,33,34)/b7-5+ |
| InChIKey | NFIOMIUSYXVPFE-FNORWQNLSA-N |
| XLogP | 4.96 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|