C20H18F3NO — CID 173202863
(E)-N-cyclopropyl-3-[2-(2-methylphenyl)-3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 173202863) has the molecular formula C20H18F3NO and a molecular weight of 345.36 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-[2-(2-methylphenyl)-3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-[2-(2-methylphenyl)-3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 173202863 |
| Molecular Formula | C20H18F3NO |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (E)-N-cyclopropyl-3-[2-(2-methylphenyl)-3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccccc1-c1c(/C=C/C(=O)NC2CC2)cccc1C(F)(F)F |
| InChI | InChI=1S/C20H18F3NO/c1-13-5-2-3-7-16(13)19-14(6-4-8-17(19)20(21,22)23)9-12-18(25)24-15-10-11-15/h2-9,12,15H,10-11H2,1H3,(H,24,25)/b12-9+ |
| InChIKey | JGBCJGPXACZCGJ-FMIVXFBMSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|